C17H24F2O3S — CID 10807548
4-(benzenesulfonyl)-5,5-difluoroundecan-6-one (PubChem CID 10807548) has the molecular formula C17H24F2O3S and a molecular weight of 346.44 g/mol. Its IUPAC name is 4-(benzenesulfonyl)-5,5-difluoroundecan-6-one.
| Compound Name | 4-(benzenesulfonyl)-5,5-difluoroundecan-6-one |
|---|---|
| PubChem CID | 10807548 |
| Molecular Formula | C17H24F2O3S |
| Molecular Weight | 346.44 g/mol |
| Exact Mass | 346.14 |
| IUPAC Name | 4-(benzenesulfonyl)-5,5-difluoroundecan-6-one |
| SMILES | CCCCCC(=O)C(F)(F)C(CCC)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C17H24F2O3S/c1-3-5-7-13-15(20)17(18,19)16(10-4-2)23(21,22)14-11-8-6-9-12-14/h6,8-9,11-12,16H,3-5,7,10,13H2,1-2H3 |
| InChIKey | MQUFASYJIIZKOY-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.44 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|