C22H28O4S — CID 132604705
[4-(benzenesulfonyl)-3-methyl-1-phenylheptan-3-yl] acetate (PubChem CID 132604705) has the molecular formula C22H28O4S and a molecular weight of 388.53 g/mol. Its IUPAC name is [4-(benzenesulfonyl)-3-methyl-1-phenylheptan-3-yl] acetate.
| Compound Name | [4-(benzenesulfonyl)-3-methyl-1-phenylheptan-3-yl] acetate |
|---|---|
| PubChem CID | 132604705 |
| Molecular Formula | C22H28O4S |
| Molecular Weight | 388.53 g/mol |
| Exact Mass | 388.17 |
| IUPAC Name | [4-(benzenesulfonyl)-3-methyl-1-phenylheptan-3-yl] acetate |
| SMILES | CCCC(C(C)(CCc1ccccc1)OC(C)=O)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C22H28O4S/c1-4-11-21(27(24,25)20-14-9-6-10-15-20)22(3,26-18(2)23)17-16-19-12-7-5-8-13-19/h5-10,12-15,21H,4,11,16-17H2,1-3H3 |
| InChIKey | YVLJFBVSPUVAGO-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.53 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |