C25H33F2NO — CID 11668493
(1S)-2,2-difluoro-1-phenyl-1-[[(1R)-1-phenylethyl]amino]undecan-3-one (PubChem CID 11668493) has the molecular formula C25H33F2NO and a molecular weight of 401.54 g/mol. Its IUPAC name is (1S)-2,2-difluoro-1-phenyl-1-[[(1R)-1-phenylethyl]amino]undecan-3-one.
| Compound Name | (1S)-2,2-difluoro-1-phenyl-1-[[(1R)-1-phenylethyl]amino]undecan-3-one |
|---|---|
| PubChem CID | 11668493 |
| Molecular Formula | C25H33F2NO |
| Molecular Weight | 401.54 g/mol |
| Exact Mass | 401.25 |
| IUPAC Name | (1S)-2,2-difluoro-1-phenyl-1-[[(1R)-1-phenylethyl]amino]undecan-3-one |
| SMILES | CCCCCCCCC(=O)C(F)(F)[C@@H](N[C@H](C)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H33F2NO/c1-3-4-5-6-7-14-19-23(29)25(26,27)24(22-17-12-9-13-18-22)28-20(2)21-15-10-8-11-16-21/h8-13,15-18,20,24,28H,3-7,14,19H2,1-2H3/t20-,24+/m1/s1 |
| InChIKey | FLEICBFYMXRPDS-YKSBVNFPSA-N |
| XLogP | 7.03 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.54 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|