C19H27Cl5N4O3S — CID 98175255
N-[(1R)-2,2-dichloro-1-[4-methyl-6-[(1S)-2,2,2-trichloro-1-(2,2-dimethylpropanoylamino)ethoxy]pyrimidin-2-yl]sulfanylethyl]-2,2-dimethylpropanamide (PubChem CID 98175255) has the molecular formula C19H27Cl5N4O3S and a molecular weight of 568.78 g/mol. Its IUPAC name is N-[(1R)-2,2-dichloro-1-[4-methyl-6-[(1S)-2,2,2-trichloro-1-(2,2-dimethylpropanoylamino)ethoxy]pyrimidin-2-yl]sulfanylethyl]-2,2-dimethylpropanamide.
| Compound Name | N-[(1R)-2,2-dichloro-1-[4-methyl-6-[(1S)-2,2,2-trichloro-1-(2,2-dimethylpropanoylamino)ethoxy]pyrimidin-2-yl]sulfanylethyl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 98175255 |
| Molecular Formula | C19H27Cl5N4O3S |
| Molecular Weight | 568.78 g/mol |
| Exact Mass | 566.02 |
| IUPAC Name | N-[(1R)-2,2-dichloro-1-[4-methyl-6-[(1S)-2,2,2-trichloro-1-(2,2-dimethylpropanoylamino)ethoxy]pyrimidin-2-yl]sulfanylethyl]-2,2-dimethylpropanamide |
| SMILES | Cc1cc(O[C@H](NC(=O)C(C)(C)C)C(Cl)(Cl)Cl)nc(S[C@@H](NC(=O)C(C)(C)C)C(Cl)Cl)n1 |
| InChI | InChI=1S/C19H27Cl5N4O3S/c1-9-8-10(31-15(19(22,23)24)28-14(30)18(5,6)7)26-16(25-9)32-12(11(20)21)27-13(29)17(2,3)4/h8,11-12,15H,1-7H3,(H,27,29)(H,28,30)/t12-,15+/m1/s1 |
| InChIKey | BWSZVTLKOKGQJQ-DOMZBBRYSA-N |
| XLogP | 5.41 |
| TPSA | 93.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.78 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|