C17H18Cl3N3O2 — CID 7114834
N-[(1S)-2,2,2-trichloro-1-(6-methyl-2-propan-2-ylpyrimidin-4-yl)oxyethyl]benzamide (PubChem CID 7114834) has the molecular formula C17H18Cl3N3O2 and a molecular weight of 402.71 g/mol. Its IUPAC name is N-[(1S)-2,2,2-trichloro-1-(6-methyl-2-propan-2-ylpyrimidin-4-yl)oxyethyl]benzamide.
| Compound Name | N-[(1S)-2,2,2-trichloro-1-(6-methyl-2-propan-2-ylpyrimidin-4-yl)oxyethyl]benzamide |
|---|---|
| PubChem CID | 7114834 |
| Molecular Formula | C17H18Cl3N3O2 |
| Molecular Weight | 402.71 g/mol |
| Exact Mass | 401.05 |
| IUPAC Name | N-[(1S)-2,2,2-trichloro-1-(6-methyl-2-propan-2-ylpyrimidin-4-yl)oxyethyl]benzamide |
| SMILES | Cc1cc(O[C@H](NC(=O)c2ccccc2)C(Cl)(Cl)Cl)nc(C(C)C)n1 |
| InChI | InChI=1S/C17H18Cl3N3O2/c1-10(2)14-21-11(3)9-13(22-14)25-16(17(18,19)20)23-15(24)12-7-5-4-6-8-12/h4-10,16H,1-3H3,(H,23,24)/t16-/m0/s1 |
| InChIKey | IQGTZUIVCSPLPU-INIZCTEOSA-N |
| XLogP | 4.41 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.71 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|