C17H17Cl3FN3O2S — CID 3404157
4-fluoro-N-[2,2,2-trichloro-1-(6-methyl-2-propylsulfanylpyrimidin-4-yl)oxyethyl]benzamide (PubChem CID 3404157) has the molecular formula C17H17Cl3FN3O2S and a molecular weight of 452.77 g/mol. Its IUPAC name is 4-fluoro-N-[2,2,2-trichloro-1-(6-methyl-2-propylsulfanylpyrimidin-4-yl)oxyethyl]benzamide.
| Compound Name | 4-fluoro-N-[2,2,2-trichloro-1-(6-methyl-2-propylsulfanylpyrimidin-4-yl)oxyethyl]benzamide |
|---|---|
| PubChem CID | 3404157 |
| Molecular Formula | C17H17Cl3FN3O2S |
| Molecular Weight | 452.77 g/mol |
| Exact Mass | 451.01 |
| IUPAC Name | 4-fluoro-N-[2,2,2-trichloro-1-(6-methyl-2-propylsulfanylpyrimidin-4-yl)oxyethyl]benzamide |
| SMILES | CCCSc1nc(C)cc(OC(NC(=O)c2ccc(F)cc2)C(Cl)(Cl)Cl)n1 |
| InChI | InChI=1S/C17H17Cl3FN3O2S/c1-3-8-27-16-22-10(2)9-13(23-16)26-15(17(18,19)20)24-14(25)11-4-6-12(21)7-5-11/h4-7,9,15H,3,8H2,1-2H3,(H,24,25) |
| InChIKey | NKCYNGOHVXIANP-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.77 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|