C15H16FN3OS — CID 40663094
4-(4-amino-6-methylpyrimidin-2-yl)sulfanyl-1-(4-fluorophenyl)butan-1-one (PubChem CID 40663094) has the molecular formula C15H16FN3OS and a molecular weight of 305.38 g/mol. Its IUPAC name is 4-(4-amino-6-methylpyrimidin-2-yl)sulfanyl-1-(4-fluorophenyl)butan-1-one.
| Compound Name | 4-(4-amino-6-methylpyrimidin-2-yl)sulfanyl-1-(4-fluorophenyl)butan-1-one |
|---|---|
| PubChem CID | 40663094 |
| Molecular Formula | C15H16FN3OS |
| Molecular Weight | 305.38 g/mol |
| Exact Mass | 305.10 |
| IUPAC Name | 4-(4-amino-6-methylpyrimidin-2-yl)sulfanyl-1-(4-fluorophenyl)butan-1-one |
| SMILES | Cc1cc(N)nc(SCCCC(=O)c2ccc(F)cc2)n1 |
| InChI | InChI=1S/C15H16FN3OS/c1-10-9-14(17)19-15(18-10)21-8-2-3-13(20)11-4-6-12(16)7-5-11/h4-7,9H,2-3,8H2,1H3,(H2,17,18,19) |
| InChIKey | DSKUIXPYMZNHIJ-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 68.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.38 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|