C12H12ClN3O2 — CID 139144561
benzoic acid;4-chloro-6-methylpyrimidin-2-amine (PubChem CID 139144561) has the molecular formula C12H12ClN3O2 and a molecular weight of 265.70 g/mol. Its IUPAC name is benzoic acid;4-chloro-6-methylpyrimidin-2-amine.
| Compound Name | benzoic acid;4-chloro-6-methylpyrimidin-2-amine |
|---|---|
| PubChem CID | 139144561 |
| Molecular Formula | C12H12ClN3O2 |
| Molecular Weight | 265.70 g/mol |
| Exact Mass | 265.06 |
| IUPAC Name | benzoic acid;4-chloro-6-methylpyrimidin-2-amine |
| SMILES | Cc1cc(Cl)nc(N)n1.O=C(O)c1ccccc1 |
| InChI | InChI=1S/C7H6O2.C5H6ClN3/c8-7(9)6-4-2-1-3-5-6;1-3-2-4(6)9-5(7)8-3/h1-5H,(H,8,9);2H,1H3,(H2,7,8,9) |
| InChIKey | MXYBSNDRAXRNET-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 89.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.70 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |