C7H9N3O2 — CID 818455
methyl 2-amino-6-methylpyrimidine-4-carboxylate (PubChem CID 818455) has the molecular formula C7H9N3O2 and a molecular weight of 167.17 g/mol. Its IUPAC name is methyl 2-amino-6-methylpyrimidine-4-carboxylate.
| Compound Name | methyl 2-amino-6-methylpyrimidine-4-carboxylate |
|---|---|
| PubChem CID | 818455 |
| Molecular Formula | C7H9N3O2 |
| Molecular Weight | 167.17 g/mol |
| Exact Mass | 167.07 |
| IUPAC Name | methyl 2-amino-6-methylpyrimidine-4-carboxylate |
| SMILES | COC(=O)c1cc(C)nc(N)n1 |
| InChI | InChI=1S/C7H9N3O2/c1-4-3-5(6(11)12-2)10-7(8)9-4/h3H,1-2H3,(H2,8,9,10) |
| InChIKey | SLLDMQQVCIJNKE-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 78.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.17 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |