About carbon dioxide;methyl 4-chloro-6-methylpyridine-2-carboxylate
carbon dioxide;methyl 4-chloro-6-methylpyridine-2-carboxylate (PubChem CID 158534965) has the molecular formula C9H8ClNO4
and a molecular weight of 229.62 g/mol. Its IUPAC name is carbon dioxide;methyl 4-chloro-6-methylpyridine-2-carboxylate.
Molecular Properties
| Compound Name | carbon dioxide;methyl 4-chloro-6-methylpyridine-2-carboxylate |
| PubChem CID | 158534965 |
| Molecular Formula | C9H8ClNO4 |
| Molecular Weight | 229.62 g/mol |
| Exact Mass | 229.01 |
| IUPAC Name | carbon dioxide;methyl 4-chloro-6-methylpyridine-2-carboxylate |
| SMILES | COC(=O)c1cc(Cl)cc(C)n1.O=C=O |
| InChI | InChI=1S/C8H8ClNO2.CO2/c1-5-3-6(9)4-7(10-5)8(11)12-2;2-1-3/h3-4H,1-2H3; |
| InChIKey | HNVFXVLXJUFJFE-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 73.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.62 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze carbon dioxide;methyl 4-chloro-6-methylpyridine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbon dioxide;methyl 4-chloro-6-methylpyridine-2-carboxylate?
The IUPAC name of carbon dioxide;methyl 4-chloro-6-methylpyridine-2-carboxylate (CID 158534965) is carbon dioxide;methyl 4-chloro-6-methylpyridine-2-carboxylate.
What is the SMILES notation for carbon dioxide;methyl 4-chloro-6-methylpyridine-2-carboxylate?
The canonical SMILES for carbon dioxide;methyl 4-chloro-6-methylpyridine-2-carboxylate is COC(=O)c1cc(Cl)cc(C)n1.O=C=O.
What is the InChIKey of carbon dioxide;methyl 4-chloro-6-methylpyridine-2-carboxylate?
The InChIKey is HNVFXVLXJUFJFE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8ClNO2.CO2/c1-5-3-6(9)4-7(10-5)8(11)12-2;2-1-3/h3-4H,1-2H3;.
What are the key properties of carbon dioxide;methyl 4-chloro-6-methylpyridine-2-carboxylate?
carbon dioxide;methyl 4-chloro-6-methylpyridine-2-carboxylate has a molecular weight of 229.62 g/mol, XLogP of 1.25, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for carbon dioxide;methyl 4-chloro-6-methylpyridine-2-carboxylate is sourced from PubChem (CID 158534965), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).