carbon dioxide;methyl 4-chloro-6-methylpyridine-2-carboxylate

C9H8ClNO4 — CID 158534965

IUPACcarbon dioxide;methyl 4-chloro-6-methylpyridine-2-carboxylate
SMILESCOC(=O)c1cc(Cl)cc(C)n1.O=C=O
InChIInChI=1S/C8H8ClNO2.CO2/c1-5-3-6(9)4-7(10-5)8(11)12-2;2-1-3/h3-4H,1-2H3;
InChIKeyHNVFXVLXJUFJFE-UHFFFAOYSA-N
MW229.62 g/mol
LogP1.25
Rot. Bonds1

About carbon dioxide;methyl 4-chloro-6-methylpyridine-2-carboxylate

carbon dioxide;methyl 4-chloro-6-methylpyridine-2-carboxylate (PubChem CID 158534965) has the molecular formula C9H8ClNO4 and a molecular weight of 229.62 g/mol. Its IUPAC name is carbon dioxide;methyl 4-chloro-6-methylpyridine-2-carboxylate.

Molecular Properties

Compound Namecarbon dioxide;methyl 4-chloro-6-methylpyridine-2-carboxylate
PubChem CID158534965
Molecular FormulaC9H8ClNO4
Molecular Weight229.62 g/mol
Exact Mass229.01
IUPAC Namecarbon dioxide;methyl 4-chloro-6-methylpyridine-2-carboxylate
SMILESCOC(=O)c1cc(Cl)cc(C)n1.O=C=O
InChIInChI=1S/C8H8ClNO2.CO2/c1-5-3-6(9)4-7(10-5)8(11)12-2;2-1-3/h3-4H,1-2H3;
InChIKeyHNVFXVLXJUFJFE-UHFFFAOYSA-N
XLogP1.25
TPSA73.33 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds1
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500229.62
LogP ≤ 51.25
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Analyze carbon dioxide;methyl 4-chloro-6-methylpyridine-2-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of carbon dioxide;methyl 4-chloro-6-methylpyridine-2-carboxylate?
The IUPAC name of carbon dioxide;methyl 4-chloro-6-methylpyridine-2-carboxylate (CID 158534965) is carbon dioxide;methyl 4-chloro-6-methylpyridine-2-carboxylate.
What is the SMILES notation for carbon dioxide;methyl 4-chloro-6-methylpyridine-2-carboxylate?
The canonical SMILES for carbon dioxide;methyl 4-chloro-6-methylpyridine-2-carboxylate is COC(=O)c1cc(Cl)cc(C)n1.O=C=O.
What is the InChIKey of carbon dioxide;methyl 4-chloro-6-methylpyridine-2-carboxylate?
The InChIKey is HNVFXVLXJUFJFE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8ClNO2.CO2/c1-5-3-6(9)4-7(10-5)8(11)12-2;2-1-3/h3-4H,1-2H3;.
What are the key properties of carbon dioxide;methyl 4-chloro-6-methylpyridine-2-carboxylate?
carbon dioxide;methyl 4-chloro-6-methylpyridine-2-carboxylate has a molecular weight of 229.62 g/mol, XLogP of 1.25, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for carbon dioxide;methyl 4-chloro-6-methylpyridine-2-carboxylate is sourced from PubChem (CID 158534965), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).