methyl 6-chloro-4,8-dimethylquinoline-2-carboxylate

C13H12ClNO2 — CID 82574609

IUPACmethyl 6-chloro-4,8-dimethylquinoline-2-carboxylate
SMILESCOC(=O)c1cc(C)c2cc(Cl)cc(C)c2n1
InChIInChI=1S/C13H12ClNO2/c1-7-5-11(13(16)17-3)15-12-8(2)4-9(14)6-10(7)12/h4-6H,1-3H3
InChIKeyKDEZRPXNPOCPRJ-UHFFFAOYSA-N
MW249.70 g/mol
LogP3.29
Rot. Bonds1

About methyl 6-chloro-4,8-dimethylquinoline-2-carboxylate

methyl 6-chloro-4,8-dimethylquinoline-2-carboxylate (PubChem CID 82574609) has the molecular formula C13H12ClNO2 and a molecular weight of 249.70 g/mol. Its IUPAC name is methyl 6-chloro-4,8-dimethylquinoline-2-carboxylate.

Molecular Properties

Compound Namemethyl 6-chloro-4,8-dimethylquinoline-2-carboxylate
PubChem CID82574609
Molecular FormulaC13H12ClNO2
Molecular Weight249.70 g/mol
Exact Mass249.06
IUPAC Namemethyl 6-chloro-4,8-dimethylquinoline-2-carboxylate
SMILESCOC(=O)c1cc(C)c2cc(Cl)cc(C)c2n1
InChIInChI=1S/C13H12ClNO2/c1-7-5-11(13(16)17-3)15-12-8(2)4-9(14)6-10(7)12/h4-6H,1-3H3
InChIKeyKDEZRPXNPOCPRJ-UHFFFAOYSA-N
XLogP3.29
TPSA39.19 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500249.70
LogP ≤ 53.29
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze methyl 6-chloro-4,8-dimethylquinoline-2-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 6-chloro-4,8-dimethylquinoline-2-carboxylate?
The IUPAC name of methyl 6-chloro-4,8-dimethylquinoline-2-carboxylate (CID 82574609) is methyl 6-chloro-4,8-dimethylquinoline-2-carboxylate.
What is the SMILES notation for methyl 6-chloro-4,8-dimethylquinoline-2-carboxylate?
The canonical SMILES for methyl 6-chloro-4,8-dimethylquinoline-2-carboxylate is COC(=O)c1cc(C)c2cc(Cl)cc(C)c2n1.
What is the InChIKey of methyl 6-chloro-4,8-dimethylquinoline-2-carboxylate?
The InChIKey is KDEZRPXNPOCPRJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12ClNO2/c1-7-5-11(13(16)17-3)15-12-8(2)4-9(14)6-10(7)12/h4-6H,1-3H3.
What are the key properties of methyl 6-chloro-4,8-dimethylquinoline-2-carboxylate?
methyl 6-chloro-4,8-dimethylquinoline-2-carboxylate has a molecular weight of 249.70 g/mol, XLogP of 3.29, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 6-chloro-4,8-dimethylquinoline-2-carboxylate is sourced from PubChem (CID 82574609), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).