C11H6Cl2FNO2 — CID 171157588
methyl 4,8-dichloro-7-fluoroquinoline-2-carboxylate (PubChem CID 171157588) has the molecular formula C11H6Cl2FNO2 and a molecular weight of 274.08 g/mol. Its IUPAC name is methyl 4,8-dichloro-7-fluoroquinoline-2-carboxylate.
| Compound Name | methyl 4,8-dichloro-7-fluoroquinoline-2-carboxylate |
|---|---|
| PubChem CID | 171157588 |
| Molecular Formula | C11H6Cl2FNO2 |
| Molecular Weight | 274.08 g/mol |
| Exact Mass | 272.98 |
| IUPAC Name | methyl 4,8-dichloro-7-fluoroquinoline-2-carboxylate |
| SMILES | COC(=O)c1cc(Cl)c2ccc(F)c(Cl)c2n1 |
| InChI | InChI=1S/C11H6Cl2FNO2/c1-17-11(16)8-4-6(12)5-2-3-7(14)9(13)10(5)15-8/h2-4H,1H3 |
| InChIKey | CIQWQHRAAFQTMX-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.08 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |