methyl 4-chloro-6,7-difluoroquinoline-2-carboxylate

C11H6ClF2NO2 — CID 63376942

IUPACmethyl 4-chloro-6,7-difluoroquinoline-2-carboxylate
SMILESCOC(=O)c1cc(Cl)c2cc(F)c(F)cc2n1
InChIInChI=1S/C11H6ClF2NO2/c1-17-11(16)10-3-6(12)5-2-7(13)8(14)4-9(5)15-10/h2-4H,1H3
InChIKeyKEAMCIQWPQIBFA-UHFFFAOYSA-N
MW257.62 g/mol
LogP2.95
Rot. Bonds1

About methyl 4-chloro-6,7-difluoroquinoline-2-carboxylate

methyl 4-chloro-6,7-difluoroquinoline-2-carboxylate (PubChem CID 63376942) has the molecular formula C11H6ClF2NO2 and a molecular weight of 257.62 g/mol. Its IUPAC name is methyl 4-chloro-6,7-difluoroquinoline-2-carboxylate.

Molecular Properties

Compound Namemethyl 4-chloro-6,7-difluoroquinoline-2-carboxylate
PubChem CID63376942
Molecular FormulaC11H6ClF2NO2
Molecular Weight257.62 g/mol
Exact Mass257.01
IUPAC Namemethyl 4-chloro-6,7-difluoroquinoline-2-carboxylate
SMILESCOC(=O)c1cc(Cl)c2cc(F)c(F)cc2n1
InChIInChI=1S/C11H6ClF2NO2/c1-17-11(16)10-3-6(12)5-2-7(13)8(14)4-9(5)15-10/h2-4H,1H3
InChIKeyKEAMCIQWPQIBFA-UHFFFAOYSA-N
XLogP2.95
TPSA39.19 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500257.62
LogP ≤ 52.95
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze methyl 4-chloro-6,7-difluoroquinoline-2-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 4-chloro-6,7-difluoroquinoline-2-carboxylate?
The IUPAC name of methyl 4-chloro-6,7-difluoroquinoline-2-carboxylate (CID 63376942) is methyl 4-chloro-6,7-difluoroquinoline-2-carboxylate.
What is the SMILES notation for methyl 4-chloro-6,7-difluoroquinoline-2-carboxylate?
The canonical SMILES for methyl 4-chloro-6,7-difluoroquinoline-2-carboxylate is COC(=O)c1cc(Cl)c2cc(F)c(F)cc2n1.
What is the InChIKey of methyl 4-chloro-6,7-difluoroquinoline-2-carboxylate?
The InChIKey is KEAMCIQWPQIBFA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H6ClF2NO2/c1-17-11(16)10-3-6(12)5-2-7(13)8(14)4-9(5)15-10/h2-4H,1H3.
What are the key properties of methyl 4-chloro-6,7-difluoroquinoline-2-carboxylate?
methyl 4-chloro-6,7-difluoroquinoline-2-carboxylate has a molecular weight of 257.62 g/mol, XLogP of 2.95, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-chloro-6,7-difluoroquinoline-2-carboxylate is sourced from PubChem (CID 63376942), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).