C13H11F2NO3 — CID 102941956
methyl 4-ethoxy-6,7-difluoroquinoline-2-carboxylate (PubChem CID 102941956) has the molecular formula C13H11F2NO3 and a molecular weight of 267.23 g/mol. Its IUPAC name is methyl 4-ethoxy-6,7-difluoroquinoline-2-carboxylate.
| Compound Name | methyl 4-ethoxy-6,7-difluoroquinoline-2-carboxylate |
|---|---|
| PubChem CID | 102941956 |
| Molecular Formula | C13H11F2NO3 |
| Molecular Weight | 267.23 g/mol |
| Exact Mass | 267.07 |
| IUPAC Name | methyl 4-ethoxy-6,7-difluoroquinoline-2-carboxylate |
| SMILES | CCOc1cc(C(=O)OC)nc2cc(F)c(F)cc12 |
| InChI | InChI=1S/C13H11F2NO3/c1-3-19-12-6-11(13(17)18-2)16-10-5-9(15)8(14)4-7(10)12/h4-6H,3H2,1-2H3 |
| InChIKey | JYUVFZYXJUDRTI-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.23 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |