C13H10F3NO3 — CID 102942041
methyl 4-ethoxy-5,7,8-trifluoroquinoline-2-carboxylate (PubChem CID 102942041) has the molecular formula C13H10F3NO3 and a molecular weight of 285.22 g/mol. Its IUPAC name is methyl 4-ethoxy-5,7,8-trifluoroquinoline-2-carboxylate.
| Compound Name | methyl 4-ethoxy-5,7,8-trifluoroquinoline-2-carboxylate |
|---|---|
| PubChem CID | 102942041 |
| Molecular Formula | C13H10F3NO3 |
| Molecular Weight | 285.22 g/mol |
| Exact Mass | 285.06 |
| IUPAC Name | methyl 4-ethoxy-5,7,8-trifluoroquinoline-2-carboxylate |
| SMILES | CCOc1cc(C(=O)OC)nc2c(F)c(F)cc(F)c12 |
| InChI | InChI=1S/C13H10F3NO3/c1-3-20-9-5-8(13(18)19-2)17-12-10(9)6(14)4-7(15)11(12)16/h4-5H,3H2,1-2H3 |
| InChIKey | YLVYQQXSANPIPR-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.22 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|