C14H13F2NO3 — CID 102941854
methyl 5,7-difluoro-4-propan-2-yloxyquinoline-2-carboxylate (PubChem CID 102941854) has the molecular formula C14H13F2NO3 and a molecular weight of 281.26 g/mol. Its IUPAC name is methyl 5,7-difluoro-4-propan-2-yloxyquinoline-2-carboxylate.
| Compound Name | methyl 5,7-difluoro-4-propan-2-yloxyquinoline-2-carboxylate |
|---|---|
| PubChem CID | 102941854 |
| Molecular Formula | C14H13F2NO3 |
| Molecular Weight | 281.26 g/mol |
| Exact Mass | 281.09 |
| IUPAC Name | methyl 5,7-difluoro-4-propan-2-yloxyquinoline-2-carboxylate |
| SMILES | COC(=O)c1cc(OC(C)C)c2c(F)cc(F)cc2n1 |
| InChI | InChI=1S/C14H13F2NO3/c1-7(2)20-12-6-11(14(18)19-3)17-10-5-8(15)4-9(16)13(10)12/h4-7H,1-3H3 |
| InChIKey | LELXTFCQGIMCCD-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.26 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |