C14H14FNO3 — CID 102941932
methyl 8-fluoro-4-propan-2-yloxyquinoline-2-carboxylate (PubChem CID 102941932) has the molecular formula C14H14FNO3 and a molecular weight of 263.27 g/mol. Its IUPAC name is methyl 8-fluoro-4-propan-2-yloxyquinoline-2-carboxylate.
| Compound Name | methyl 8-fluoro-4-propan-2-yloxyquinoline-2-carboxylate |
|---|---|
| PubChem CID | 102941932 |
| Molecular Formula | C14H14FNO3 |
| Molecular Weight | 263.27 g/mol |
| Exact Mass | 263.10 |
| IUPAC Name | methyl 8-fluoro-4-propan-2-yloxyquinoline-2-carboxylate |
| SMILES | COC(=O)c1cc(OC(C)C)c2cccc(F)c2n1 |
| InChI | InChI=1S/C14H14FNO3/c1-8(2)19-12-7-11(14(17)18-3)16-13-9(12)5-4-6-10(13)15/h4-8H,1-3H3 |
| InChIKey | BXOLMYPBJICUHE-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.27 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |