C13H10BrF2NO3 — CID 102942154
methyl 5-bromo-4-ethoxy-6,8-difluoroquinoline-2-carboxylate (PubChem CID 102942154) has the molecular formula C13H10BrF2NO3 and a molecular weight of 346.13 g/mol. Its IUPAC name is methyl 5-bromo-4-ethoxy-6,8-difluoroquinoline-2-carboxylate.
| Compound Name | methyl 5-bromo-4-ethoxy-6,8-difluoroquinoline-2-carboxylate |
|---|---|
| PubChem CID | 102942154 |
| Molecular Formula | C13H10BrF2NO3 |
| Molecular Weight | 346.13 g/mol |
| Exact Mass | 344.98 |
| IUPAC Name | methyl 5-bromo-4-ethoxy-6,8-difluoroquinoline-2-carboxylate |
| SMILES | CCOc1cc(C(=O)OC)nc2c(F)cc(F)c(Br)c12 |
| InChI | InChI=1S/C13H10BrF2NO3/c1-3-20-9-5-8(13(18)19-2)17-12-7(16)4-6(15)11(14)10(9)12/h4-5H,3H2,1-2H3 |
| InChIKey | YSCRMVAWJHGFTQ-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.13 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|