C14H13Br2NO4 — CID 103416918
methyl 6,8-dibromo-4-ethoxy-5-methoxyquinoline-2-carboxylate (PubChem CID 103416918) has the molecular formula C14H13Br2NO4 and a molecular weight of 419.07 g/mol. Its IUPAC name is methyl 6,8-dibromo-4-ethoxy-5-methoxyquinoline-2-carboxylate.
| Compound Name | methyl 6,8-dibromo-4-ethoxy-5-methoxyquinoline-2-carboxylate |
|---|---|
| PubChem CID | 103416918 |
| Molecular Formula | C14H13Br2NO4 |
| Molecular Weight | 419.07 g/mol |
| Exact Mass | 416.92 |
| IUPAC Name | methyl 6,8-dibromo-4-ethoxy-5-methoxyquinoline-2-carboxylate |
| SMILES | CCOc1cc(C(=O)OC)nc2c(Br)cc(Br)c(OC)c12 |
| InChI | InChI=1S/C14H13Br2NO4/c1-4-21-10-6-9(14(18)20-3)17-12-7(15)5-8(16)13(19-2)11(10)12/h5-6H,4H2,1-3H3 |
| InChIKey | LXKNJCOJOKYPHC-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 57.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.07 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |