C9H10BrNO4 — CID 86205250
methyl 6-bromo-4,5-dimethoxypyridine-2-carboxylate (PubChem CID 86205250) has the molecular formula C9H10BrNO4 and a molecular weight of 276.09 g/mol. Its IUPAC name is methyl 6-bromo-4,5-dimethoxypyridine-2-carboxylate.
| Compound Name | methyl 6-bromo-4,5-dimethoxypyridine-2-carboxylate |
|---|---|
| PubChem CID | 86205250 |
| Molecular Formula | C9H10BrNO4 |
| Molecular Weight | 276.09 g/mol |
| Exact Mass | 274.98 |
| IUPAC Name | methyl 6-bromo-4,5-dimethoxypyridine-2-carboxylate |
| SMILES | COC(=O)c1cc(OC)c(OC)c(Br)n1 |
| InChI | InChI=1S/C9H10BrNO4/c1-13-6-4-5(9(12)15-3)11-8(10)7(6)14-2/h4H,1-3H3 |
| InChIKey | GOYXLBBPBTXHBV-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 57.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.09 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|