methyl 3-bromo-6,7-dimethoxyquinoxaline-2-carboxylate

C12H11BrN2O4 — CID 133060908

IUPACmethyl 3-bromo-6,7-dimethoxyquinoxaline-2-carboxylate
SMILESCOC(=O)c1nc2cc(OC)c(OC)cc2nc1Br
InChIInChI=1S/C12H11BrN2O4/c1-17-8-4-6-7(5-9(8)18-2)15-11(13)10(14-6)12(16)19-3/h4-5H,1-3H3
InChIKeyTXZOWHCSSQLVNB-UHFFFAOYSA-N
MW327.13 g/mol
LogP2.20
Rot. Bonds3

About methyl 3-bromo-6,7-dimethoxyquinoxaline-2-carboxylate

methyl 3-bromo-6,7-dimethoxyquinoxaline-2-carboxylate (PubChem CID 133060908) has the molecular formula C12H11BrN2O4 and a molecular weight of 327.13 g/mol. Its IUPAC name is methyl 3-bromo-6,7-dimethoxyquinoxaline-2-carboxylate.

Molecular Properties

Compound Namemethyl 3-bromo-6,7-dimethoxyquinoxaline-2-carboxylate
PubChem CID133060908
Molecular FormulaC12H11BrN2O4
Molecular Weight327.13 g/mol
Exact Mass325.99
IUPAC Namemethyl 3-bromo-6,7-dimethoxyquinoxaline-2-carboxylate
SMILESCOC(=O)c1nc2cc(OC)c(OC)cc2nc1Br
InChIInChI=1S/C12H11BrN2O4/c1-17-8-4-6-7(5-9(8)18-2)15-11(13)10(14-6)12(16)19-3/h4-5H,1-3H3
InChIKeyTXZOWHCSSQLVNB-UHFFFAOYSA-N
XLogP2.20
TPSA70.54 Ų
H-Bond Donors
H-Bond Acceptors6
Rotatable Bonds3
Heavy Atoms19
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500327.13
LogP ≤ 52.20
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 106

Analyze methyl 3-bromo-6,7-dimethoxyquinoxaline-2-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 3-bromo-6,7-dimethoxyquinoxaline-2-carboxylate?
The IUPAC name of methyl 3-bromo-6,7-dimethoxyquinoxaline-2-carboxylate (CID 133060908) is methyl 3-bromo-6,7-dimethoxyquinoxaline-2-carboxylate.
What is the SMILES notation for methyl 3-bromo-6,7-dimethoxyquinoxaline-2-carboxylate?
The canonical SMILES for methyl 3-bromo-6,7-dimethoxyquinoxaline-2-carboxylate is COC(=O)c1nc2cc(OC)c(OC)cc2nc1Br.
What is the InChIKey of methyl 3-bromo-6,7-dimethoxyquinoxaline-2-carboxylate?
The InChIKey is TXZOWHCSSQLVNB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11BrN2O4/c1-17-8-4-6-7(5-9(8)18-2)15-11(13)10(14-6)12(16)19-3/h4-5H,1-3H3.
What are the key properties of methyl 3-bromo-6,7-dimethoxyquinoxaline-2-carboxylate?
methyl 3-bromo-6,7-dimethoxyquinoxaline-2-carboxylate has a molecular weight of 327.13 g/mol, XLogP of 2.20, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-bromo-6,7-dimethoxyquinoxaline-2-carboxylate is sourced from PubChem (CID 133060908), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).