C13H17BrN2O5 — CID 168977230
methyl 6-bromo-5-methoxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]pyridine-2-carboxylate (PubChem CID 168977230) has the molecular formula C13H17BrN2O5 and a molecular weight of 361.19 g/mol. Its IUPAC name is methyl 6-bromo-5-methoxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]pyridine-2-carboxylate.
| Compound Name | methyl 6-bromo-5-methoxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]pyridine-2-carboxylate |
|---|---|
| PubChem CID | 168977230 |
| Molecular Formula | C13H17BrN2O5 |
| Molecular Weight | 361.19 g/mol |
| Exact Mass | 360.03 |
| IUPAC Name | methyl 6-bromo-5-methoxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]pyridine-2-carboxylate |
| SMILES | COC(=O)c1nc(Br)c(OC)cc1NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C13H17BrN2O5/c1-13(2,3)21-12(18)15-7-6-8(19-4)10(14)16-9(7)11(17)20-5/h6H,1-5H3,(H,15,18) |
| InChIKey | XYGDVKUPERHDSS-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 86.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.19 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|