C14H20N2O5 — CID 170637976
tert-butyl N-(5-methoxy-2,4-dimethyl-3-nitrophenyl)carbamate (PubChem CID 170637976) has the molecular formula C14H20N2O5 and a molecular weight of 296.32 g/mol. Its IUPAC name is tert-butyl N-(5-methoxy-2,4-dimethyl-3-nitrophenyl)carbamate.
| Compound Name | tert-butyl N-(5-methoxy-2,4-dimethyl-3-nitrophenyl)carbamate |
|---|---|
| PubChem CID | 170637976 |
| Molecular Formula | C14H20N2O5 |
| Molecular Weight | 296.32 g/mol |
| Exact Mass | 296.14 |
| IUPAC Name | tert-butyl N-(5-methoxy-2,4-dimethyl-3-nitrophenyl)carbamate |
| SMILES | COc1cc(NC(=O)OC(C)(C)C)c(C)c([N+](=O)[O-])c1C |
| InChI | InChI=1S/C14H20N2O5/c1-8-10(15-13(17)21-14(3,4)5)7-11(20-6)9(2)12(8)16(18)19/h7H,1-6H3,(H,15,17) |
| InChIKey | RVJLETSQRDLYPV-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.32 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|