methyl 4,5-dimethoxy-6-(1,3-thiazol-4-yl)pyridine-2-carboxylate

C12H12N2O4S — CID 54270021

IUPACmethyl 4,5-dimethoxy-6-(1,3-thiazol-4-yl)pyridine-2-carboxylate
SMILESCOC(=O)c1cc(OC)c(OC)c(-c2cscn2)n1
InChIInChI=1S/C12H12N2O4S/c1-16-9-4-7(12(15)18-3)14-10(11(9)17-2)8-5-19-6-13-8/h4-6H,1-3H3
InChIKeyRJLXFRBASVXZBI-UHFFFAOYSA-N
MW280.31 g/mol
LogP2.01
Rot. Bonds4

About methyl 4,5-dimethoxy-6-(1,3-thiazol-4-yl)pyridine-2-carboxylate

methyl 4,5-dimethoxy-6-(1,3-thiazol-4-yl)pyridine-2-carboxylate (PubChem CID 54270021) has the molecular formula C12H12N2O4S and a molecular weight of 280.31 g/mol. Its IUPAC name is methyl 4,5-dimethoxy-6-(1,3-thiazol-4-yl)pyridine-2-carboxylate.

Molecular Properties

Compound Namemethyl 4,5-dimethoxy-6-(1,3-thiazol-4-yl)pyridine-2-carboxylate
PubChem CID54270021
Molecular FormulaC12H12N2O4S
Molecular Weight280.31 g/mol
Exact Mass280.05
IUPAC Namemethyl 4,5-dimethoxy-6-(1,3-thiazol-4-yl)pyridine-2-carboxylate
SMILESCOC(=O)c1cc(OC)c(OC)c(-c2cscn2)n1
InChIInChI=1S/C12H12N2O4S/c1-16-9-4-7(12(15)18-3)14-10(11(9)17-2)8-5-19-6-13-8/h4-6H,1-3H3
InChIKeyRJLXFRBASVXZBI-UHFFFAOYSA-N
XLogP2.01
TPSA70.54 Ų
H-Bond Donors
H-Bond Acceptors7
Rotatable Bonds4
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500280.31
LogP ≤ 52.01
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 107

Analyze methyl 4,5-dimethoxy-6-(1,3-thiazol-4-yl)pyridine-2-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 4,5-dimethoxy-6-(1,3-thiazol-4-yl)pyridine-2-carboxylate?
The IUPAC name of methyl 4,5-dimethoxy-6-(1,3-thiazol-4-yl)pyridine-2-carboxylate (CID 54270021) is methyl 4,5-dimethoxy-6-(1,3-thiazol-4-yl)pyridine-2-carboxylate.
What is the SMILES notation for methyl 4,5-dimethoxy-6-(1,3-thiazol-4-yl)pyridine-2-carboxylate?
The canonical SMILES for methyl 4,5-dimethoxy-6-(1,3-thiazol-4-yl)pyridine-2-carboxylate is COC(=O)c1cc(OC)c(OC)c(-c2cscn2)n1.
What is the InChIKey of methyl 4,5-dimethoxy-6-(1,3-thiazol-4-yl)pyridine-2-carboxylate?
The InChIKey is RJLXFRBASVXZBI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12N2O4S/c1-16-9-4-7(12(15)18-3)14-10(11(9)17-2)8-5-19-6-13-8/h4-6H,1-3H3.
What are the key properties of methyl 4,5-dimethoxy-6-(1,3-thiazol-4-yl)pyridine-2-carboxylate?
methyl 4,5-dimethoxy-6-(1,3-thiazol-4-yl)pyridine-2-carboxylate has a molecular weight of 280.31 g/mol, XLogP of 2.01, 4 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4,5-dimethoxy-6-(1,3-thiazol-4-yl)pyridine-2-carboxylate is sourced from PubChem (CID 54270021), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).