C12H13NO3S — CID 5239941
4-(2,3,4-trimethoxyphenyl)-1,3-thiazole (PubChem CID 5239941) has the molecular formula C12H13NO3S and a molecular weight of 251.31 g/mol. Its IUPAC name is 4-(2,3,4-trimethoxyphenyl)-1,3-thiazole.
| Compound Name | 4-(2,3,4-trimethoxyphenyl)-1,3-thiazole |
|---|---|
| PubChem CID | 5239941 |
| Molecular Formula | C12H13NO3S |
| Molecular Weight | 251.31 g/mol |
| Exact Mass | 251.06 |
| IUPAC Name | 4-(2,3,4-trimethoxyphenyl)-1,3-thiazole |
| SMILES | COc1ccc(-c2cscn2)c(OC)c1OC |
| InChI | InChI=1S/C12H13NO3S/c1-14-10-5-4-8(9-6-17-7-13-9)11(15-2)12(10)16-3/h4-7H,1-3H3 |
| InChIKey | RHNSYJHZNCXEDW-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 40.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.31 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |