C17H19N3O3S — CID 56877204
4-[2-[2-(2,3,4-trimethoxyphenyl)imidazol-1-yl]ethyl]-1,3-thiazole (PubChem CID 56877204) has the molecular formula C17H19N3O3S and a molecular weight of 345.42 g/mol. Its IUPAC name is 4-[2-[2-(2,3,4-trimethoxyphenyl)imidazol-1-yl]ethyl]-1,3-thiazole.
| Compound Name | 4-[2-[2-(2,3,4-trimethoxyphenyl)imidazol-1-yl]ethyl]-1,3-thiazole |
|---|---|
| PubChem CID | 56877204 |
| Molecular Formula | C17H19N3O3S |
| Molecular Weight | 345.42 g/mol |
| Exact Mass | 345.11 |
| IUPAC Name | 4-[2-[2-(2,3,4-trimethoxyphenyl)imidazol-1-yl]ethyl]-1,3-thiazole |
| SMILES | COc1ccc(-c2nccn2CCc2cscn2)c(OC)c1OC |
| InChI | InChI=1S/C17H19N3O3S/c1-21-14-5-4-13(15(22-2)16(14)23-3)17-18-7-9-20(17)8-6-12-10-24-11-19-12/h4-5,7,9-11H,6,8H2,1-3H3 |
| InChIKey | SBAUOVPQOZJWHI-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 58.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.42 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |