C18H22N4O4 — CID 154924176
2-(2,3-dimethoxyphenyl)-1-[2-(1-methylpyrazol-4-yl)ethyl]imidazole;formic acid (PubChem CID 154924176) has the molecular formula C18H22N4O4 and a molecular weight of 358.40 g/mol. Its IUPAC name is 2-(2,3-dimethoxyphenyl)-1-[2-(1-methylpyrazol-4-yl)ethyl]imidazole;formic acid.
| Compound Name | 2-(2,3-dimethoxyphenyl)-1-[2-(1-methylpyrazol-4-yl)ethyl]imidazole;formic acid |
|---|---|
| PubChem CID | 154924176 |
| Molecular Formula | C18H22N4O4 |
| Molecular Weight | 358.40 g/mol |
| Exact Mass | 358.16 |
| IUPAC Name | 2-(2,3-dimethoxyphenyl)-1-[2-(1-methylpyrazol-4-yl)ethyl]imidazole;formic acid |
| SMILES | COc1cccc(-c2nccn2CCc2cnn(C)c2)c1OC.O=CO |
| InChI | InChI=1S/C17H20N4O2.CH2O2/c1-20-12-13(11-19-20)7-9-21-10-8-18-17(21)14-5-4-6-15(22-2)16(14)23-3;2-1-3/h4-6,8,10-12H,7,9H2,1-3H3;1H,(H,2,3) |
| InChIKey | LJFBFUKUZXVYIB-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.40 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|