C17H22N2O5S — CID 154567633
4-[2-(2,3,4-trimethoxyphenyl)imidazol-1-yl]thiane 1,1-dioxide (PubChem CID 154567633) has the molecular formula C17H22N2O5S and a molecular weight of 366.44 g/mol. Its IUPAC name is 4-[2-(2,3,4-trimethoxyphenyl)imidazol-1-yl]thiane 1,1-dioxide.
| Compound Name | 4-[2-(2,3,4-trimethoxyphenyl)imidazol-1-yl]thiane 1,1-dioxide |
|---|---|
| PubChem CID | 154567633 |
| Molecular Formula | C17H22N2O5S |
| Molecular Weight | 366.44 g/mol |
| Exact Mass | 366.12 |
| IUPAC Name | 4-[2-(2,3,4-trimethoxyphenyl)imidazol-1-yl]thiane 1,1-dioxide |
| SMILES | COc1ccc(-c2nccn2C2CCS(=O)(=O)CC2)c(OC)c1OC |
| InChI | InChI=1S/C17H22N2O5S/c1-22-14-5-4-13(15(23-2)16(14)24-3)17-18-8-9-19(17)12-6-10-25(20,21)11-7-12/h4-5,8-9,12H,6-7,10-11H2,1-3H3 |
| InChIKey | SSQLCXHRXXJVDG-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 79.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.44 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |