C18H18N2O2S — CID 154563991
4-(2-naphthalen-1-ylimidazol-1-yl)thiane 1,1-dioxide (PubChem CID 154563991) has the molecular formula C18H18N2O2S and a molecular weight of 326.42 g/mol. Its IUPAC name is 4-(2-naphthalen-1-ylimidazol-1-yl)thiane 1,1-dioxide.
| Compound Name | 4-(2-naphthalen-1-ylimidazol-1-yl)thiane 1,1-dioxide |
|---|---|
| PubChem CID | 154563991 |
| Molecular Formula | C18H18N2O2S |
| Molecular Weight | 326.42 g/mol |
| Exact Mass | 326.11 |
| IUPAC Name | 4-(2-naphthalen-1-ylimidazol-1-yl)thiane 1,1-dioxide |
| SMILES | O=S1(=O)CCC(n2ccnc2-c2cccc3ccccc23)CC1 |
| InChI | InChI=1S/C18H18N2O2S/c21-23(22)12-8-15(9-13-23)20-11-10-19-18(20)17-7-3-5-14-4-1-2-6-16(14)17/h1-7,10-11,15H,8-9,12-13H2 |
| InChIKey | JYDJLBHJMIQPIK-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.42 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |