C14H15FN2O2S — CID 154821323
4-[2-(2-fluorophenyl)imidazol-1-yl]thiane 1,1-dioxide (PubChem CID 154821323) has the molecular formula C14H15FN2O2S and a molecular weight of 294.35 g/mol. Its IUPAC name is 4-[2-(2-fluorophenyl)imidazol-1-yl]thiane 1,1-dioxide.
| Compound Name | 4-[2-(2-fluorophenyl)imidazol-1-yl]thiane 1,1-dioxide |
|---|---|
| PubChem CID | 154821323 |
| Molecular Formula | C14H15FN2O2S |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.08 |
| IUPAC Name | 4-[2-(2-fluorophenyl)imidazol-1-yl]thiane 1,1-dioxide |
| SMILES | O=S1(=O)CCC(n2ccnc2-c2ccccc2F)CC1 |
| InChI | InChI=1S/C14H15FN2O2S/c15-13-4-2-1-3-12(13)14-16-7-8-17(14)11-5-9-20(18,19)10-6-11/h1-4,7-8,11H,5-6,9-10H2 |
| InChIKey | XWUYJQPAKUBHQO-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |