C15H16N4O2S — CID 154815819
4-(2-pyrazolo[1,5-a]pyridin-7-ylimidazol-1-yl)thiane 1,1-dioxide (PubChem CID 154815819) has the molecular formula C15H16N4O2S and a molecular weight of 316.39 g/mol. Its IUPAC name is 4-(2-pyrazolo[1,5-a]pyridin-7-ylimidazol-1-yl)thiane 1,1-dioxide.
| Compound Name | 4-(2-pyrazolo[1,5-a]pyridin-7-ylimidazol-1-yl)thiane 1,1-dioxide |
|---|---|
| PubChem CID | 154815819 |
| Molecular Formula | C15H16N4O2S |
| Molecular Weight | 316.39 g/mol |
| Exact Mass | 316.10 |
| IUPAC Name | 4-(2-pyrazolo[1,5-a]pyridin-7-ylimidazol-1-yl)thiane 1,1-dioxide |
| SMILES | O=S1(=O)CCC(n2ccnc2-c2cccc3ccnn23)CC1 |
| InChI | InChI=1S/C15H16N4O2S/c20-22(21)10-5-12(6-11-22)18-9-8-16-15(18)14-3-1-2-13-4-7-17-19(13)14/h1-4,7-9,12H,5-6,10-11H2 |
| InChIKey | ZTBQJZTVLHHOPJ-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 69.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.39 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |