C12H16N4O2S — CID 155918918
4-[2-(1-methylimidazol-2-yl)imidazol-1-yl]thiane 1,1-dioxide (PubChem CID 155918918) has the molecular formula C12H16N4O2S and a molecular weight of 280.35 g/mol. Its IUPAC name is 4-[2-(1-methylimidazol-2-yl)imidazol-1-yl]thiane 1,1-dioxide.
| Compound Name | 4-[2-(1-methylimidazol-2-yl)imidazol-1-yl]thiane 1,1-dioxide |
|---|---|
| PubChem CID | 155918918 |
| Molecular Formula | C12H16N4O2S |
| Molecular Weight | 280.35 g/mol |
| Exact Mass | 280.10 |
| IUPAC Name | 4-[2-(1-methylimidazol-2-yl)imidazol-1-yl]thiane 1,1-dioxide |
| SMILES | Cn1ccnc1-c1nccn1C1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C12H16N4O2S/c1-15-6-4-13-11(15)12-14-5-7-16(12)10-2-8-19(17,18)9-3-10/h4-7,10H,2-3,8-9H2,1H3 |
| InChIKey | CUHRKIHAMOGKAY-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 69.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.35 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |