About 3-(1-methylimidazol-2-yl)sulfanylthiolane 1,1-dioxide
3-(1-methylimidazol-2-yl)sulfanylthiolane 1,1-dioxide (PubChem CID 5128091) has the molecular formula C8H12N2O2S2
and a molecular weight of 232.33 g/mol. Its IUPAC name is 3-(1-methylimidazol-2-yl)sulfanylthiolane 1,1-dioxide.
Molecular Properties
| Compound Name | 3-(1-methylimidazol-2-yl)sulfanylthiolane 1,1-dioxide |
| PubChem CID | 5128091 |
| Molecular Formula | C8H12N2O2S2 |
| Molecular Weight | 232.33 g/mol |
| Exact Mass | 232.03 |
| IUPAC Name | 3-(1-methylimidazol-2-yl)sulfanylthiolane 1,1-dioxide |
| SMILES | Cn1ccnc1SC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C8H12N2O2S2/c1-10-4-3-9-8(10)13-7-2-5-14(11,12)6-7/h3-4,7H,2,5-6H2,1H3 |
| InChIKey | OVGFPDQLODBARS-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.33 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-(1-methylimidazol-2-yl)sulfanylthiolane 1,1-dioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1-methylimidazol-2-yl)sulfanylthiolane 1,1-dioxide?
The IUPAC name of 3-(1-methylimidazol-2-yl)sulfanylthiolane 1,1-dioxide (CID 5128091) is 3-(1-methylimidazol-2-yl)sulfanylthiolane 1,1-dioxide.
What is the SMILES notation for 3-(1-methylimidazol-2-yl)sulfanylthiolane 1,1-dioxide?
The canonical SMILES for 3-(1-methylimidazol-2-yl)sulfanylthiolane 1,1-dioxide is Cn1ccnc1SC1CCS(=O)(=O)C1.
What is the InChIKey of 3-(1-methylimidazol-2-yl)sulfanylthiolane 1,1-dioxide?
The InChIKey is OVGFPDQLODBARS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2O2S2/c1-10-4-3-9-8(10)13-7-2-5-14(11,12)6-7/h3-4,7H,2,5-6H2,1H3.
What are the key properties of 3-(1-methylimidazol-2-yl)sulfanylthiolane 1,1-dioxide?
3-(1-methylimidazol-2-yl)sulfanylthiolane 1,1-dioxide has a molecular weight of 232.33 g/mol, XLogP of 0.70, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1-methylimidazol-2-yl)sulfanylthiolane 1,1-dioxide is sourced from PubChem (CID 5128091), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).