C9H7NO3S — CID 97034345
methyl 5-(1,3-thiazol-4-yl)furan-2-carboxylate (PubChem CID 97034345) has the molecular formula C9H7NO3S and a molecular weight of 209.23 g/mol. Its IUPAC name is methyl 5-(1,3-thiazol-4-yl)furan-2-carboxylate.
| Compound Name | methyl 5-(1,3-thiazol-4-yl)furan-2-carboxylate |
|---|---|
| PubChem CID | 97034345 |
| Molecular Formula | C9H7NO3S |
| Molecular Weight | 209.23 g/mol |
| Exact Mass | 209.01 |
| IUPAC Name | methyl 5-(1,3-thiazol-4-yl)furan-2-carboxylate |
| SMILES | COC(=O)c1ccc(-c2cscn2)o1 |
| InChI | InChI=1S/C9H7NO3S/c1-12-9(11)8-3-2-7(13-8)6-4-14-5-10-6/h2-5H,1H3 |
| InChIKey | IQFRAMFYBNCWFJ-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.23 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |