C13H13Br2N3O3 — CID 103416812
ethyl 6,8-dibromo-4-hydrazinyl-5-methoxyquinoline-3-carboxylate (PubChem CID 103416812) has the molecular formula C13H13Br2N3O3 and a molecular weight of 419.07 g/mol. Its IUPAC name is ethyl 6,8-dibromo-4-hydrazinyl-5-methoxyquinoline-3-carboxylate.
| Compound Name | ethyl 6,8-dibromo-4-hydrazinyl-5-methoxyquinoline-3-carboxylate |
|---|---|
| PubChem CID | 103416812 |
| Molecular Formula | C13H13Br2N3O3 |
| Molecular Weight | 419.07 g/mol |
| Exact Mass | 416.93 |
| IUPAC Name | ethyl 6,8-dibromo-4-hydrazinyl-5-methoxyquinoline-3-carboxylate |
| SMILES | CCOC(=O)c1cnc2c(Br)cc(Br)c(OC)c2c1NN |
| InChI | InChI=1S/C13H13Br2N3O3/c1-3-21-13(19)6-5-17-11-7(14)4-8(15)12(20-2)9(11)10(6)18-16/h4-5H,3,16H2,1-2H3,(H,17,18) |
| InChIKey | KPWJWUORLGBFID-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 86.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.07 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|