C12H11FIN3O2 — CID 114261072
ethyl 7-fluoro-4-hydrazinyl-8-iodoquinoline-3-carboxylate (PubChem CID 114261072) has the molecular formula C12H11FIN3O2 and a molecular weight of 375.14 g/mol. Its IUPAC name is ethyl 7-fluoro-4-hydrazinyl-8-iodoquinoline-3-carboxylate.
| Compound Name | ethyl 7-fluoro-4-hydrazinyl-8-iodoquinoline-3-carboxylate |
|---|---|
| PubChem CID | 114261072 |
| Molecular Formula | C12H11FIN3O2 |
| Molecular Weight | 375.14 g/mol |
| Exact Mass | 374.99 |
| IUPAC Name | ethyl 7-fluoro-4-hydrazinyl-8-iodoquinoline-3-carboxylate |
| SMILES | CCOC(=O)c1cnc2c(I)c(F)ccc2c1NN |
| InChI | InChI=1S/C12H11FIN3O2/c1-2-19-12(18)7-5-16-11-6(10(7)17-15)3-4-8(13)9(11)14/h3-5H,2,15H2,1H3,(H,16,17) |
| InChIKey | WXKHFUQGAADBDB-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.14 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|