C14H17N3O2 — CID 62250481
ethyl 4-hydrazinyl-5,8-dimethylquinoline-3-carboxylate (PubChem CID 62250481) has the molecular formula C14H17N3O2 and a molecular weight of 259.31 g/mol. Its IUPAC name is ethyl 4-hydrazinyl-5,8-dimethylquinoline-3-carboxylate.
| Compound Name | ethyl 4-hydrazinyl-5,8-dimethylquinoline-3-carboxylate |
|---|---|
| PubChem CID | 62250481 |
| Molecular Formula | C14H17N3O2 |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.13 |
| IUPAC Name | ethyl 4-hydrazinyl-5,8-dimethylquinoline-3-carboxylate |
| SMILES | CCOC(=O)c1cnc2c(C)ccc(C)c2c1NN |
| InChI | InChI=1S/C14H17N3O2/c1-4-19-14(18)10-7-16-12-9(3)6-5-8(2)11(12)13(10)17-15/h5-7H,4,15H2,1-3H3,(H,16,17) |
| InChIKey | KFSNIYUMHURLIZ-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|