C19H20N2O7PS-3 — CID 20529032
ethyl 8-methoxy-5-methyl-4-[(3-methylthiophen-2-yl)amino]quinoline-3-carboxylate phosphate (PubChem CID 20529032) has the molecular formula C19H20N2O7PS-3 and a molecular weight of 451.42 g/mol. Its IUPAC name is ethyl 8-methoxy-5-methyl-4-[(3-methylthiophen-2-yl)amino]quinoline-3-carboxylate phosphate.
| Compound Name | ethyl 8-methoxy-5-methyl-4-[(3-methylthiophen-2-yl)amino]quinoline-3-carboxylate phosphate |
|---|---|
| PubChem CID | 20529032 |
| Molecular Formula | C19H20N2O7PS-3 |
| Molecular Weight | 451.42 g/mol |
| Exact Mass | 451.07 |
| IUPAC Name | ethyl 8-methoxy-5-methyl-4-[(3-methylthiophen-2-yl)amino]quinoline-3-carboxylate phosphate |
| SMILES | CCOC(=O)c1cnc2c(OC)ccc(C)c2c1Nc1sccc1C.O=P([O-])([O-])[O-] |
| InChI | InChI=1S/C19H20N2O3S.H3O4P/c1-5-24-19(22)13-10-20-17-14(23-4)7-6-11(2)15(17)16(13)21-18-12(3)8-9-25-18;1-5(2,3)4/h6-10H,5H2,1-4H3,(H,20,21);(H3,1,2,3,4)/p-3 |
| InChIKey | BQOPBRUMUIHKTM-UHFFFAOYSA-K |
| XLogP | 2.02 |
| TPSA | 146.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.42 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|