About methyl 7-chloro-4-oxo-1H-quinoline-2-carboxylate;methyl 4,7-dichloroquinoline-2-carboxylate
methyl 7-chloro-4-oxo-1H-quinoline-2-carboxylate;methyl 4,7-dichloroquinoline-2-carboxylate (PubChem CID 161384100) has the molecular formula C22H15Cl3N2O5
and a molecular weight of 493.73 g/mol. Its IUPAC name is methyl 7-chloro-4-oxo-1H-quinoline-2-carboxylate;methyl 4,7-dichloroquinoline-2-carboxylate.
Molecular Properties
| Compound Name | methyl 7-chloro-4-oxo-1H-quinoline-2-carboxylate;methyl 4,7-dichloroquinoline-2-carboxylate |
| PubChem CID | 161384100 |
| Molecular Formula | C22H15Cl3N2O5 |
| Molecular Weight | 493.73 g/mol |
| Exact Mass | 492.00 |
| IUPAC Name | methyl 7-chloro-4-oxo-1H-quinoline-2-carboxylate;methyl 4,7-dichloroquinoline-2-carboxylate |
| SMILES | COC(=O)c1cc(=O)c2ccc(Cl)cc2[nH]1.COC(=O)c1cc(Cl)c2ccc(Cl)cc2n1 |
| InChI | InChI=1S/C11H7Cl2NO2.C11H8ClNO3/c1-16-11(15)10-5-8(13)7-3-2-6(12)4-9(7)14-10;1-16-11(15)9-5-10(14)7-3-2-6(12)4-8(7)13-9/h2-5H,1H3;2-5H,1H3,(H,13,14) |
| InChIKey | VSCJWTGDCJWAKB-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 98.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 493.73 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze methyl 7-chloro-4-oxo-1H-quinoline-2-carboxylate;methyl 4,7-dichloroquinoline-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 7-chloro-4-oxo-1H-quinoline-2-carboxylate;methyl 4,7-dichloroquinoline-2-carboxylate?
The IUPAC name of methyl 7-chloro-4-oxo-1H-quinoline-2-carboxylate;methyl 4,7-dichloroquinoline-2-carboxylate (CID 161384100) is methyl 7-chloro-4-oxo-1H-quinoline-2-carboxylate;methyl 4,7-dichloroquinoline-2-carboxylate.
What is the SMILES notation for methyl 7-chloro-4-oxo-1H-quinoline-2-carboxylate;methyl 4,7-dichloroquinoline-2-carboxylate?
The canonical SMILES for methyl 7-chloro-4-oxo-1H-quinoline-2-carboxylate;methyl 4,7-dichloroquinoline-2-carboxylate is COC(=O)c1cc(=O)c2ccc(Cl)cc2[nH]1.COC(=O)c1cc(Cl)c2ccc(Cl)cc2n1.
What is the InChIKey of methyl 7-chloro-4-oxo-1H-quinoline-2-carboxylate;methyl 4,7-dichloroquinoline-2-carboxylate?
The InChIKey is VSCJWTGDCJWAKB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H7Cl2NO2.C11H8ClNO3/c1-16-11(15)10-5-8(13)7-3-2-6(12)4-9(7)14-10;1-16-11(15)9-5-10(14)7-3-2-6(12)4-8(7)13-9/h2-5H,1H3;2-5H,1H3,(H,13,14).
What are the key properties of methyl 7-chloro-4-oxo-1H-quinoline-2-carboxylate;methyl 4,7-dichloroquinoline-2-carboxylate?
methyl 7-chloro-4-oxo-1H-quinoline-2-carboxylate;methyl 4,7-dichloroquinoline-2-carboxylate has a molecular weight of 493.73 g/mol, XLogP of 5.30, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 7-chloro-4-oxo-1H-quinoline-2-carboxylate;methyl 4,7-dichloroquinoline-2-carboxylate is sourced from PubChem (CID 161384100), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).