C13H9ClFNO4 — CID 118170889
dimethyl 6-chloro-8-fluoroquinoline-2,4-dicarboxylate (PubChem CID 118170889) has the molecular formula C13H9ClFNO4 and a molecular weight of 297.67 g/mol. Its IUPAC name is dimethyl 6-chloro-8-fluoroquinoline-2,4-dicarboxylate.
| Compound Name | dimethyl 6-chloro-8-fluoroquinoline-2,4-dicarboxylate |
|---|---|
| PubChem CID | 118170889 |
| Molecular Formula | C13H9ClFNO4 |
| Molecular Weight | 297.67 g/mol |
| Exact Mass | 297.02 |
| IUPAC Name | dimethyl 6-chloro-8-fluoroquinoline-2,4-dicarboxylate |
| SMILES | COC(=O)c1cc(C(=O)OC)c2cc(Cl)cc(F)c2n1 |
| InChI | InChI=1S/C13H9ClFNO4/c1-19-12(17)8-5-10(13(18)20-2)16-11-7(8)3-6(14)4-9(11)15/h3-5H,1-2H3 |
| InChIKey | ZTGKKIPVCQEOLB-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 65.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.67 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |