C12H8Cl3NO2 — CID 113445998
methyl 4,5,8-trichloro-6-methylquinoline-2-carboxylate (PubChem CID 113445998) has the molecular formula C12H8Cl3NO2 and a molecular weight of 304.56 g/mol. Its IUPAC name is methyl 4,5,8-trichloro-6-methylquinoline-2-carboxylate.
| Compound Name | methyl 4,5,8-trichloro-6-methylquinoline-2-carboxylate |
|---|---|
| PubChem CID | 113445998 |
| Molecular Formula | C12H8Cl3NO2 |
| Molecular Weight | 304.56 g/mol |
| Exact Mass | 302.96 |
| IUPAC Name | methyl 4,5,8-trichloro-6-methylquinoline-2-carboxylate |
| SMILES | COC(=O)c1cc(Cl)c2c(Cl)c(C)cc(Cl)c2n1 |
| InChI | InChI=1S/C12H8Cl3NO2/c1-5-3-7(14)11-9(10(5)15)6(13)4-8(16-11)12(17)18-2/h3-4H,1-2H3 |
| InChIKey | SSANSWRXCFVVQI-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.56 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |