About methyl 4-chloro-6-fluoropyridine-2-carboxylate;methyl 4-chloropyridine-2-carboxylate;hydroiodide
methyl 4-chloro-6-fluoropyridine-2-carboxylate;methyl 4-chloropyridine-2-carboxylate;hydroiodide (PubChem CID 159623363) has the molecular formula C14H12Cl2FIN2O4
and a molecular weight of 489.07 g/mol. Its IUPAC name is methyl 4-chloro-6-fluoropyridine-2-carboxylate;methyl 4-chloropyridine-2-carboxylate;hydroiodide.
Molecular Properties
| Compound Name | methyl 4-chloro-6-fluoropyridine-2-carboxylate;methyl 4-chloropyridine-2-carboxylate;hydroiodide |
| PubChem CID | 159623363 |
| Molecular Formula | C14H12Cl2FIN2O4 |
| Molecular Weight | 489.07 g/mol |
| Exact Mass | 487.92 |
| IUPAC Name | methyl 4-chloro-6-fluoropyridine-2-carboxylate;methyl 4-chloropyridine-2-carboxylate;hydroiodide |
| SMILES | COC(=O)c1cc(Cl)cc(F)n1.COC(=O)c1cc(Cl)ccn1.I |
| InChI | InChI=1S/C7H5ClFNO2.C7H6ClNO2.HI/c1-12-7(11)5-2-4(8)3-6(9)10-5;1-11-7(10)6-4-5(8)2-3-9-6;/h2-3H,1H3;2-4H,1H3;1H |
| InChIKey | AOFPZZPWUSAQJP-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 78.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 489.07 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze methyl 4-chloro-6-fluoropyridine-2-carboxylate;methyl 4-chloropyridine-2-carboxylate;hydroiodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-chloro-6-fluoropyridine-2-carboxylate;methyl 4-chloropyridine-2-carboxylate;hydroiodide?
The IUPAC name of methyl 4-chloro-6-fluoropyridine-2-carboxylate;methyl 4-chloropyridine-2-carboxylate;hydroiodide (CID 159623363) is methyl 4-chloro-6-fluoropyridine-2-carboxylate;methyl 4-chloropyridine-2-carboxylate;hydroiodide.
What is the SMILES notation for methyl 4-chloro-6-fluoropyridine-2-carboxylate;methyl 4-chloropyridine-2-carboxylate;hydroiodide?
The canonical SMILES for methyl 4-chloro-6-fluoropyridine-2-carboxylate;methyl 4-chloropyridine-2-carboxylate;hydroiodide is COC(=O)c1cc(Cl)cc(F)n1.COC(=O)c1cc(Cl)ccn1.I.
What is the InChIKey of methyl 4-chloro-6-fluoropyridine-2-carboxylate;methyl 4-chloropyridine-2-carboxylate;hydroiodide?
The InChIKey is AOFPZZPWUSAQJP-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5ClFNO2.C7H6ClNO2.HI/c1-12-7(11)5-2-4(8)3-6(9)10-5;1-11-7(10)6-4-5(8)2-3-9-6;/h2-3H,1H3;2-4H,1H3;1H.
What are the key properties of methyl 4-chloro-6-fluoropyridine-2-carboxylate;methyl 4-chloropyridine-2-carboxylate;hydroiodide?
methyl 4-chloro-6-fluoropyridine-2-carboxylate;methyl 4-chloropyridine-2-carboxylate;hydroiodide has a molecular weight of 489.07 g/mol, XLogP of 3.80, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-chloro-6-fluoropyridine-2-carboxylate;methyl 4-chloropyridine-2-carboxylate;hydroiodide is sourced from PubChem (CID 159623363), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).