C14H10ClNO3 — CID 59763976
1-(4-chloro-2-pyridinyl)-2-(4-methoxyphenyl)ethane-1,2-dione (PubChem CID 59763976) has the molecular formula C14H10ClNO3 and a molecular weight of 275.69 g/mol. Its IUPAC name is 1-(4-chloro-2-pyridinyl)-2-(4-methoxyphenyl)ethane-1,2-dione.
| Compound Name | 1-(4-chloro-2-pyridinyl)-2-(4-methoxyphenyl)ethane-1,2-dione |
|---|---|
| PubChem CID | 59763976 |
| Molecular Formula | C14H10ClNO3 |
| Molecular Weight | 275.69 g/mol |
| Exact Mass | 275.03 |
| IUPAC Name | 1-(4-chloro-2-pyridinyl)-2-(4-methoxyphenyl)ethane-1,2-dione |
| SMILES | COc1ccc(C(=O)C(=O)c2cc(Cl)ccn2)cc1 |
| InChI | InChI=1S/C14H10ClNO3/c1-19-11-4-2-9(3-5-11)13(17)14(18)12-8-10(15)6-7-16-12/h2-8H,1H3 |
| InChIKey | BVEKJMDKBSVHOF-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.69 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|