C22H21ClN2O3 — CID 46820321
N-[1,2-bis(4-methoxyphenyl)ethyl]-4-chloropyridine-2-carboxamide (PubChem CID 46820321) has the molecular formula C22H21ClN2O3 and a molecular weight of 396.87 g/mol. Its IUPAC name is N-[1,2-bis(4-methoxyphenyl)ethyl]-4-chloropyridine-2-carboxamide.
| Compound Name | N-[1,2-bis(4-methoxyphenyl)ethyl]-4-chloropyridine-2-carboxamide |
|---|---|
| PubChem CID | 46820321 |
| Molecular Formula | C22H21ClN2O3 |
| Molecular Weight | 396.87 g/mol |
| Exact Mass | 396.12 |
| IUPAC Name | N-[1,2-bis(4-methoxyphenyl)ethyl]-4-chloropyridine-2-carboxamide |
| SMILES | COc1ccc(CC(NC(=O)c2cc(Cl)ccn2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C22H21ClN2O3/c1-27-18-7-3-15(4-8-18)13-20(16-5-9-19(28-2)10-6-16)25-22(26)21-14-17(23)11-12-24-21/h3-12,14,20H,13H2,1-2H3,(H,25,26) |
| InChIKey | WZDNVJYPJZDYJF-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.87 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |