C14H12Cl2N2O2 — CID 110004659
4-chloro-N-[1-(4-chlorophenyl)-2-hydroxyethyl]pyridine-2-carboxamide (PubChem CID 110004659) has the molecular formula C14H12Cl2N2O2 and a molecular weight of 311.17 g/mol. Its IUPAC name is 4-chloro-N-[1-(4-chlorophenyl)-2-hydroxyethyl]pyridine-2-carboxamide.
| Compound Name | 4-chloro-N-[1-(4-chlorophenyl)-2-hydroxyethyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 110004659 |
| Molecular Formula | C14H12Cl2N2O2 |
| Molecular Weight | 311.17 g/mol |
| Exact Mass | 310.03 |
| IUPAC Name | 4-chloro-N-[1-(4-chlorophenyl)-2-hydroxyethyl]pyridine-2-carboxamide |
| SMILES | O=C(NC(CO)c1ccc(Cl)cc1)c1cc(Cl)ccn1 |
| InChI | InChI=1S/C14H12Cl2N2O2/c15-10-3-1-9(2-4-10)13(8-19)18-14(20)12-7-11(16)5-6-17-12/h1-7,13,19H,8H2,(H,18,20) |
| InChIKey | ALIWEXJJIRSHLI-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.17 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |