C23H20ClF2NO3 — CID 46820313
N-[1,2-bis(4-methoxyphenyl)ethyl]-2-chloro-4,5-difluorobenzamide (PubChem CID 46820313) has the molecular formula C23H20ClF2NO3 and a molecular weight of 431.87 g/mol. Its IUPAC name is N-[1,2-bis(4-methoxyphenyl)ethyl]-2-chloro-4,5-difluorobenzamide.
| Compound Name | N-[1,2-bis(4-methoxyphenyl)ethyl]-2-chloro-4,5-difluorobenzamide |
|---|---|
| PubChem CID | 46820313 |
| Molecular Formula | C23H20ClF2NO3 |
| Molecular Weight | 431.87 g/mol |
| Exact Mass | 431.11 |
| IUPAC Name | N-[1,2-bis(4-methoxyphenyl)ethyl]-2-chloro-4,5-difluorobenzamide |
| SMILES | COc1ccc(CC(NC(=O)c2cc(F)c(F)cc2Cl)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C23H20ClF2NO3/c1-29-16-7-3-14(4-8-16)11-22(15-5-9-17(30-2)10-6-15)27-23(28)18-12-20(25)21(26)13-19(18)24/h3-10,12-13,22H,11H2,1-2H3,(H,27,28) |
| InChIKey | XMBAGSAEWQCODH-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.87 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|