C25H26FNO3 — CID 46820318
N-[1,2-bis(4-methoxyphenyl)ethyl]-3-(2-fluorophenyl)propanamide (PubChem CID 46820318) has the molecular formula C25H26FNO3 and a molecular weight of 407.49 g/mol. Its IUPAC name is N-[1,2-bis(4-methoxyphenyl)ethyl]-3-(2-fluorophenyl)propanamide.
| Compound Name | N-[1,2-bis(4-methoxyphenyl)ethyl]-3-(2-fluorophenyl)propanamide |
|---|---|
| PubChem CID | 46820318 |
| Molecular Formula | C25H26FNO3 |
| Molecular Weight | 407.49 g/mol |
| Exact Mass | 407.19 |
| IUPAC Name | N-[1,2-bis(4-methoxyphenyl)ethyl]-3-(2-fluorophenyl)propanamide |
| SMILES | COc1ccc(CC(NC(=O)CCc2ccccc2F)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C25H26FNO3/c1-29-21-12-7-18(8-13-21)17-24(20-9-14-22(30-2)15-10-20)27-25(28)16-11-19-5-3-4-6-23(19)26/h3-10,12-15,24H,11,16-17H2,1-2H3,(H,27,28) |
| InChIKey | UBUWIGMQEYWBSL-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.49 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |