C18H18FNO3 — CID 45461619
3-[3-(2-fluorophenyl)propanoylamino]-3-phenylpropanoic acid (PubChem CID 45461619) has the molecular formula C18H18FNO3 and a molecular weight of 315.34 g/mol. Its IUPAC name is 3-[3-(2-fluorophenyl)propanoylamino]-3-phenylpropanoic acid.
| Compound Name | 3-[3-(2-fluorophenyl)propanoylamino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 45461619 |
| Molecular Formula | C18H18FNO3 |
| Molecular Weight | 315.34 g/mol |
| Exact Mass | 315.13 |
| IUPAC Name | 3-[3-(2-fluorophenyl)propanoylamino]-3-phenylpropanoic acid |
| SMILES | O=C(O)CC(NC(=O)CCc1ccccc1F)c1ccccc1 |
| InChI | InChI=1S/C18H18FNO3/c19-15-9-5-4-6-13(15)10-11-17(21)20-16(12-18(22)23)14-7-2-1-3-8-14/h1-9,16H,10-12H2,(H,20,21)(H,22,23) |
| InChIKey | WTGUZMFDJZIQPU-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.34 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |