C23H19F3N2O3 — CID 97000116
N-(3,4-difluorophenyl)-N'-[(1S)-2-(4-fluorophenyl)-1-(4-methoxyphenyl)ethyl]oxamide (PubChem CID 97000116) has the molecular formula C23H19F3N2O3 and a molecular weight of 428.41 g/mol. Its IUPAC name is N-(3,4-difluorophenyl)-N'-[(1S)-2-(4-fluorophenyl)-1-(4-methoxyphenyl)ethyl]oxamide.
| Compound Name | N-(3,4-difluorophenyl)-N'-[(1S)-2-(4-fluorophenyl)-1-(4-methoxyphenyl)ethyl]oxamide |
|---|---|
| PubChem CID | 97000116 |
| Molecular Formula | C23H19F3N2O3 |
| Molecular Weight | 428.41 g/mol |
| Exact Mass | 428.13 |
| IUPAC Name | N-(3,4-difluorophenyl)-N'-[(1S)-2-(4-fluorophenyl)-1-(4-methoxyphenyl)ethyl]oxamide |
| SMILES | COc1ccc([C@H](Cc2ccc(F)cc2)NC(=O)C(=O)Nc2ccc(F)c(F)c2)cc1 |
| InChI | InChI=1S/C23H19F3N2O3/c1-31-18-9-4-15(5-10-18)21(12-14-2-6-16(24)7-3-14)28-23(30)22(29)27-17-8-11-19(25)20(26)13-17/h2-11,13,21H,12H2,1H3,(H,27,29)(H,28,30)/t21-/m0/s1 |
| InChIKey | HLZLKYNGLLNZCU-NRFANRHFSA-N |
| XLogP | 4.15 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.41 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|