C22H23FN4O3 — CID 97068333
N-(2,5-dimethylpyrazol-3-yl)-N'-[(1S)-2-(4-fluorophenyl)-1-(4-methoxyphenyl)ethyl]oxamide (PubChem CID 97068333) has the molecular formula C22H23FN4O3 and a molecular weight of 410.45 g/mol. Its IUPAC name is N-(2,5-dimethylpyrazol-3-yl)-N'-[(1S)-2-(4-fluorophenyl)-1-(4-methoxyphenyl)ethyl]oxamide.
| Compound Name | N-(2,5-dimethylpyrazol-3-yl)-N'-[(1S)-2-(4-fluorophenyl)-1-(4-methoxyphenyl)ethyl]oxamide |
|---|---|
| PubChem CID | 97068333 |
| Molecular Formula | C22H23FN4O3 |
| Molecular Weight | 410.45 g/mol |
| Exact Mass | 410.18 |
| IUPAC Name | N-(2,5-dimethylpyrazol-3-yl)-N'-[(1S)-2-(4-fluorophenyl)-1-(4-methoxyphenyl)ethyl]oxamide |
| SMILES | COc1ccc([C@H](Cc2ccc(F)cc2)NC(=O)C(=O)Nc2cc(C)nn2C)cc1 |
| InChI | InChI=1S/C22H23FN4O3/c1-14-12-20(27(2)26-14)25-22(29)21(28)24-19(13-15-4-8-17(23)9-5-15)16-6-10-18(30-3)11-7-16/h4-12,19H,13H2,1-3H3,(H,24,28)(H,25,29)/t19-/m0/s1 |
| InChIKey | QQKPWVUTAPHMKY-IBGZPJMESA-N |
| XLogP | 2.91 |
| TPSA | 85.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.45 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|